C11H16F3N — CID 177146394
(2E)-N,3,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)cyclopentan-1-imine (PubChem CID 177146394) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (2E)-N,3,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)cyclopentan-1-imine.
| Compound Name | (2E)-N,3,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)cyclopentan-1-imine |
|---|---|
| PubChem CID | 177146394 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2E)-N,3,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)cyclopentan-1-imine |
| SMILES | C/N=C1C(=C(\C)C(F)(F)F)/C(C)CC/1C |
| InChI | InChI=1S/C11H16F3N/c1-6-5-7(2)10(15-4)9(6)8(3)11(12,13)14/h6-7H,5H2,1-4H3/b9-8+,15-10+ |
| InChIKey | OTIOYRUORUJQGB-RQADFKIXSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|