C11H17F2N — CID 177146657
(2E)-2-(3,3-difluorobutan-2-ylidene)-N,5-dimethylcyclopentan-1-imine (PubChem CID 177146657) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (2E)-2-(3,3-difluorobutan-2-ylidene)-N,5-dimethylcyclopentan-1-imine.
| Compound Name | (2E)-2-(3,3-difluorobutan-2-ylidene)-N,5-dimethylcyclopentan-1-imine |
|---|---|
| PubChem CID | 177146657 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (2E)-2-(3,3-difluorobutan-2-ylidene)-N,5-dimethylcyclopentan-1-imine |
| SMILES | C/N=C1C(=C(\C)C(C)(F)F)/CCC/1C |
| InChI | InChI=1S/C11H17F2N/c1-7-5-6-9(10(7)14-4)8(2)11(3,12)13/h7H,5-6H2,1-4H3/b9-8+,14-10+ |
| InChIKey | FUOCSAYNNUMYTA-ANVLWLQNSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|