C16H31N — CID 123488300
(Z)-3,7-diethyl-N,5,6-trimethylnon-5-en-4-imine (PubChem CID 123488300) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (Z)-3,7-diethyl-N,5,6-trimethylnon-5-en-4-imine.
| Compound Name | (Z)-3,7-diethyl-N,5,6-trimethylnon-5-en-4-imine |
|---|---|
| PubChem CID | 123488300 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (Z)-3,7-diethyl-N,5,6-trimethylnon-5-en-4-imine |
| SMILES | CCC(CC)/C(C)=C(C)\C(=N\C)C(CC)CC |
| InChI | InChI=1S/C16H31N/c1-8-14(9-2)12(5)13(6)16(17-7)15(10-3)11-4/h14-15H,8-11H2,1-7H3/b13-12-,17-16- |
| InChIKey | SAMSEVWUIWTTRW-NQJJCMTOSA-N |
| XLogP | 5.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|