C15H26N2O3S — CID 177147919
tert-butyl 1-[(E)-tert-butylsulfinyliminomethyl]-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 177147919) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is tert-butyl 1-[(E)-tert-butylsulfinyliminomethyl]-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | tert-butyl 1-[(E)-tert-butylsulfinyliminomethyl]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 177147919 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl 1-[(E)-tert-butylsulfinyliminomethyl]-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1(/C=N/S(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C15H26N2O3S/c1-13(2,3)20-12(18)17-9-11-7-15(17,8-11)10-16-21(19)14(4,5)6/h10-11H,7-9H2,1-6H3/b16-10+ |
| InChIKey | ZNCLSGNWJFYKQD-MHWRWJLKSA-N |
| XLogP | 2.92 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|