C13H23FN2O3S — CID 156731806
tert-butyl 3-(tert-butylsulfinyliminomethyl)-3-fluoroazetidine-1-carboxylate (PubChem CID 156731806) has the molecular formula C13H23FN2O3S and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl 3-(tert-butylsulfinyliminomethyl)-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(tert-butylsulfinyliminomethyl)-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 156731806 |
| Molecular Formula | C13H23FN2O3S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl 3-(tert-butylsulfinyliminomethyl)-3-fluoroazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(C=NS(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H23FN2O3S/c1-11(2,3)19-10(17)16-8-13(14,9-16)7-15-20(18)12(4,5)6/h7H,8-9H2,1-6H3 |
| InChIKey | CJDDRJXNOUTRJU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|