C24H27BrN2O3 — CID 177153702
but-1-yne;ethanimine;methyl 8-bromo-4-phenylmethoxy-1,2-dihydroisoquinoline-3-carboxylate (PubChem CID 177153702) has the molecular formula C24H27BrN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is but-1-yne;ethanimine;methyl 8-bromo-4-phenylmethoxy-1,2-dihydroisoquinoline-3-carboxylate.
| Compound Name | but-1-yne;ethanimine;methyl 8-bromo-4-phenylmethoxy-1,2-dihydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177153702 |
| Molecular Formula | C24H27BrN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | but-1-yne;ethanimine;methyl 8-bromo-4-phenylmethoxy-1,2-dihydroisoquinoline-3-carboxylate |
| SMILES | C#CCC.COC(=O)C1=C(OCc2ccccc2)c2cccc(Br)c2CN1.[H]/N=C/C |
| InChI | InChI=1S/C18H16BrNO3.C4H6.C2H5N/c1-22-18(21)16-17(23-11-12-6-3-2-4-7-12)13-8-5-9-15(19)14(13)10-20-16;1-3-4-2;1-2-3/h2-9,20H,10-11H2,1H3;1H,4H2,2H3;2-3H,1H3/b;;3-2+ |
| InChIKey | VQBSPFFUXSRXIU-CITOEQSFSA-N |
| XLogP | 5.30 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|