C31H34N2O4 — CID 177153943
acetylene;methyl 2-[(Z)-ethylideneamino]-8-phenoxy-4-phenylmethoxy-1H-isoquinoline-3-carboxylate;propane (PubChem CID 177153943) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is acetylene;methyl 2-[(Z)-ethylideneamino]-8-phenoxy-4-phenylmethoxy-1H-isoquinoline-3-carboxylate;propane.
| Compound Name | acetylene;methyl 2-[(Z)-ethylideneamino]-8-phenoxy-4-phenylmethoxy-1H-isoquinoline-3-carboxylate;propane |
|---|---|
| PubChem CID | 177153943 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | acetylene;methyl 2-[(Z)-ethylideneamino]-8-phenoxy-4-phenylmethoxy-1H-isoquinoline-3-carboxylate;propane |
| SMILES | C#C.C/C=N\N1Cc2c(Oc3ccccc3)cccc2C(OCc2ccccc2)=C1C(=O)OC.CCC |
| InChI | InChI=1S/C26H24N2O4.C3H8.C2H2/c1-3-27-28-17-22-21(15-10-16-23(22)32-20-13-8-5-9-14-20)25(24(28)26(29)30-2)31-18-19-11-6-4-7-12-19;1-3-2;1-2/h3-16H,17-18H2,1-2H3;3H2,1-2H3;1-2H/b27-3-;; |
| InChIKey | YYOIHUWXMKDEQS-AUHSVEKVSA-N |
| XLogP | 7.02 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|