C24H26N4O4 — CID 177154248
but-1-yne;methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-pyridin-2-yl-1H-isoquinoline-3-carbonyl]amino]acetate (PubChem CID 177154248) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is but-1-yne;methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-pyridin-2-yl-1H-isoquinoline-3-carbonyl]amino]acetate.
| Compound Name | but-1-yne;methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-pyridin-2-yl-1H-isoquinoline-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 177154248 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | but-1-yne;methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-pyridin-2-yl-1H-isoquinoline-3-carbonyl]amino]acetate |
| SMILES | C#CCC.C/C=N\N1Cc2c(cccc2-c2ccccn2)C(O)=C1C(=O)NCC(=O)OC |
| InChI | InChI=1S/C20H20N4O4.C4H6/c1-3-23-24-12-15-13(16-9-4-5-10-21-16)7-6-8-14(15)19(26)18(24)20(27)22-11-17(25)28-2;1-3-4-2/h3-10,26H,11-12H2,1-2H3,(H,22,27);1H,4H2,2H3/b23-3-; |
| InChIKey | QLMPPLVNIZCRBE-MVPMQIBZSA-N |
| XLogP | 3.12 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|