C20H26N4O4 — CID 177153411
methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-piperidin-1-yl-1H-isoquinoline-3-carbonyl]amino]acetate (PubChem CID 177153411) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-piperidin-1-yl-1H-isoquinoline-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-piperidin-1-yl-1H-isoquinoline-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 177153411 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methyl 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-piperidin-1-yl-1H-isoquinoline-3-carbonyl]amino]acetate |
| SMILES | C/C=N\N1Cc2c(cccc2N2CCCCC2)C(O)=C1C(=O)NCC(=O)OC |
| InChI | InChI=1S/C20H26N4O4/c1-3-22-24-13-15-14(8-7-9-16(15)23-10-5-4-6-11-23)19(26)18(24)20(27)21-12-17(25)28-2/h3,7-9,26H,4-6,10-13H2,1-2H3,(H,21,27)/b22-3- |
| InChIKey | CIGOIWLVJRTISY-XQFZAKLLSA-N |
| XLogP | 2.01 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|