C22H27N3O4 — CID 177153752
but-1-yne;methyl 2-[[8-cyclopropyl-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetate (PubChem CID 177153752) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is but-1-yne;methyl 2-[[8-cyclopropyl-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetate.
| Compound Name | but-1-yne;methyl 2-[[8-cyclopropyl-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 177153752 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | but-1-yne;methyl 2-[[8-cyclopropyl-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetate |
| SMILES | C#CCC.C/C=N\N1Cc2c(cccc2C2CC2)C(O)=C1C(=O)NCC(=O)OC |
| InChI | InChI=1S/C18H21N3O4.C4H6/c1-3-20-21-10-14-12(11-7-8-11)5-4-6-13(14)17(23)16(21)18(24)19-9-15(22)25-2;1-3-4-2/h3-6,11,23H,7-10H2,1-2H3,(H,19,24);1H,4H2,2H3/b20-3-; |
| InChIKey | NIMSJLYDBNIWAR-YXZUUGGESA-N |
| XLogP | 2.93 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|