C22H23N3O4 — CID 177153420
2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-(2-phenylethyl)-1H-isoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 177153420) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-(2-phenylethyl)-1H-isoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-(2-phenylethyl)-1H-isoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 177153420 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[[2-[(Z)-ethylideneamino]-4-hydroxy-8-(2-phenylethyl)-1H-isoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | C/C=N\N1Cc2c(CCc3ccccc3)cccc2C(O)=C1C(=O)NCC(=O)O |
| InChI | InChI=1S/C22H23N3O4/c1-2-24-25-14-18-16(12-11-15-7-4-3-5-8-15)9-6-10-17(18)21(28)20(25)22(29)23-13-19(26)27/h2-10,28H,11-14H2,1H3,(H,23,29)(H,26,27)/b24-2- |
| InChIKey | VWLXHQLIQLMIMB-LCHOGURTSA-N |
| XLogP | 2.72 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|