C20H17F2N3O4 — CID 177154210
2-[[8-(3,5-difluorophenyl)-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 177154210) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-[[8-(3,5-difluorophenyl)-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[8-(3,5-difluorophenyl)-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 177154210 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[[8-(3,5-difluorophenyl)-2-[(Z)-ethylideneamino]-4-hydroxy-1H-isoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | C/C=N\N1Cc2c(cccc2-c2cc(F)cc(F)c2)C(O)=C1C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H17F2N3O4/c1-2-24-25-10-16-14(11-6-12(21)8-13(22)7-11)4-3-5-15(16)19(28)18(25)20(29)23-9-17(26)27/h2-8,28H,9-10H2,1H3,(H,23,29)(H,26,27)/b24-2- |
| InChIKey | IQFCJSMVEUFIQC-LCHOGURTSA-N |
| XLogP | 2.88 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|