C22H21N3O4 — CID 177153780
2-[[1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-phenylisoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 177153780) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[[1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-phenylisoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-phenylisoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 177153780 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[[1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-phenylisoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | CC=C1c2cc(-c3ccccc3)ccc2C(O)=C(C(=O)NCC(=O)O)N1/N=C\C |
| InChI | InChI=1S/C22H21N3O4/c1-3-18-17-12-15(14-8-6-5-7-9-14)10-11-16(17)21(28)20(25(18)24-4-2)22(29)23-13-19(26)27/h3-12,28H,13H2,1-2H3,(H,23,29)(H,26,27)/b18-3?,24-4- |
| InChIKey | CSHIOVZNFIIYBD-WWBSFCGBSA-N |
| XLogP | 3.46 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|