C8H19N — CID 177158434
N,N-dimethylbut-1-en-2-amine;ethane (PubChem CID 177158434) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is N,N-dimethylbut-1-en-2-amine;ethane.
| Compound Name | N,N-dimethylbut-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 177158434 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,N-dimethylbut-1-en-2-amine;ethane |
| SMILES | C=C(CC)N(C)C.CC |
| InChI | InChI=1S/C6H13N.C2H6/c1-5-6(2)7(3)4;1-2/h2,5H2,1,3-4H3;1-2H3 |
| InChIKey | DJJFKHDTCSQOPZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |