C10H13N5O2 — CID 177160752
1-(6-propan-2-yl-1,2,4-triazin-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 177160752) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-(6-propan-2-yl-1,2,4-triazin-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(6-propan-2-yl-1,2,4-triazin-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177160752 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(6-propan-2-yl-1,2,4-triazin-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | CC(C)c1cnc(N2CCC(=O)NC2=O)nn1 |
| InChI | InChI=1S/C10H13N5O2/c1-6(2)7-5-11-9(14-13-7)15-4-3-8(16)12-10(15)17/h5-6H,3-4H2,1-2H3,(H,12,16,17) |
| InChIKey | RPUDHRNEUXOKBP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |