C17H19N3O3 — CID 164567682
1-(8-methoxy-7-propan-2-ylisoquinolin-4-yl)-1,3-diazinane-2,4-dione (PubChem CID 164567682) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(8-methoxy-7-propan-2-ylisoquinolin-4-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(8-methoxy-7-propan-2-ylisoquinolin-4-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 164567682 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(8-methoxy-7-propan-2-ylisoquinolin-4-yl)-1,3-diazinane-2,4-dione |
| SMILES | COc1c(C(C)C)ccc2c(N3CCC(=O)NC3=O)cncc12 |
| InChI | InChI=1S/C17H19N3O3/c1-10(2)11-4-5-12-13(16(11)23-3)8-18-9-14(12)20-7-6-15(21)19-17(20)22/h4-5,8-10H,6-7H2,1-3H3,(H,19,21,22) |
| InChIKey | CPDIRRGZNCRBBX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |