C13H8F4S — CID 177164088
4-[(2,3,5,6-tetrafluorophenyl)methyl]benzenethiol (PubChem CID 177164088) has the molecular formula C13H8F4S and a molecular weight of 272.27 g/mol. Its IUPAC name is 4-[(2,3,5,6-tetrafluorophenyl)methyl]benzenethiol.
| Compound Name | 4-[(2,3,5,6-tetrafluorophenyl)methyl]benzenethiol |
|---|---|
| PubChem CID | 177164088 |
| Molecular Formula | C13H8F4S |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 4-[(2,3,5,6-tetrafluorophenyl)methyl]benzenethiol |
| SMILES | Fc1cc(F)c(F)c(Cc2ccc(S)cc2)c1F |
| InChI | InChI=1S/C13H8F4S/c14-10-6-11(15)13(17)9(12(10)16)5-7-1-3-8(18)4-2-7/h1-4,6,18H,5H2 |
| InChIKey | HQBVYXSCIFLTLV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|