C17H18F3NO4 — CID 177164686
ethyl 2-[(1S,5S,7aS)-3-oxo-1-[2-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]acetate (PubChem CID 177164686) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is ethyl 2-[(1S,5S,7aS)-3-oxo-1-[2-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]acetate.
| Compound Name | ethyl 2-[(1S,5S,7aS)-3-oxo-1-[2-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]acetate |
|---|---|
| PubChem CID | 177164686 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | ethyl 2-[(1S,5S,7aS)-3-oxo-1-[2-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@H]2[C@H](c3ccccc3C(F)(F)F)OC(=O)N12 |
| InChI | InChI=1S/C17H18F3NO4/c1-2-24-14(22)9-10-7-8-13-15(25-16(23)21(10)13)11-5-3-4-6-12(11)17(18,19)20/h3-6,10,13,15H,2,7-9H2,1H3/t10-,13-,15-/m0/s1 |
| InChIKey | UXBADHODTFNXIU-XEGUGMAKSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |