C19H24F3NO3 — CID 91932541
2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-benzyl-3,3-dimethyl-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-yl]acetate (PubChem CID 91932541) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-benzyl-3,3-dimethyl-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-yl]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-benzyl-3,3-dimethyl-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-yl]acetate |
|---|---|
| PubChem CID | 91932541 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(5R,7aS)-7a-benzyl-3,3-dimethyl-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-yl]acetate |
| SMILES | CC1(C)OC[C@@]2(Cc3ccccc3)CC[C@H](CC(=O)OCC(F)(F)F)N12 |
| InChI | InChI=1S/C19H24F3NO3/c1-17(2)23-15(10-16(24)25-13-19(20,21)22)8-9-18(23,12-26-17)11-14-6-4-3-5-7-14/h3-7,15H,8-13H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | JDDRLDADUVLPIH-QAPCUYQASA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |