C14H28BNO4 — CID 177166107
tert-butyl 4-(2-hydroxyoxaboretan-3-yl)piperidine-1-carboxylate;ethane (PubChem CID 177166107) has the molecular formula C14H28BNO4 and a molecular weight of 285.19 g/mol. Its IUPAC name is tert-butyl 4-(2-hydroxyoxaboretan-3-yl)piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(2-hydroxyoxaboretan-3-yl)piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 177166107 |
| Molecular Formula | C14H28BNO4 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl 4-(2-hydroxyoxaboretan-3-yl)piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(C2COB2O)CC1 |
| InChI | InChI=1S/C12H22BNO4.C2H6/c1-12(2,3)18-11(15)14-6-4-9(5-7-14)10-8-17-13(10)16;1-2/h9-10,16H,4-8H2,1-3H3;1-2H3 |
| InChIKey | TTZODZNBLIJMDY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|