C40H35N5O5 — CID 177167788
(2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(pyridine-2-carbonylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid (PubChem CID 177167788) has the molecular formula C40H35N5O5 and a molecular weight of 665.75 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(pyridine-2-carbonylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(pyridine-2-carbonylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid |
|---|---|
| PubChem CID | 177167788 |
| Molecular Formula | C40H35N5O5 |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(pyridine-2-carbonylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid |
| SMILES | O=C(C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccccn1)C(=O)O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H35N5O5/c46-36(45-40(28-14-4-1-5-15-28,29-16-6-2-7-17-29)30-18-8-3-9-19-30)25-35(39(49)50)44-38(48)34(43-37(47)33-22-12-13-23-41-33)24-27-26-42-32-21-11-10-20-31(27)32/h1-23,26,34-35,42H,24-25H2,(H,43,47)(H,44,48)(H,45,46)(H,49,50)/t34-,35-/m0/s1 |
| InChIKey | GQLJPBAOMFWDDK-PXLJZGITSA-N |
| XLogP | 4.97 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|