C35H34N4O4 — CID 177167789
(2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid (PubChem CID 177167789) has the molecular formula C35H34N4O4 and a molecular weight of 574.68 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid |
|---|---|
| PubChem CID | 177167789 |
| Molecular Formula | C35H34N4O4 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoic acid |
| SMILES | CN[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H34N4O4/c1-36-30(21-24-23-37-29-20-12-11-19-28(24)29)33(41)38-31(34(42)43)22-32(40)39-35(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-20,23,30-31,36-37H,21-22H2,1H3,(H,38,41)(H,39,40)(H,42,43)/t30-,31-/m0/s1 |
| InChIKey | VTKMVTAEADYGFU-CONSDPRKSA-N |
| XLogP | 4.37 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|