C45H52N4O5 — CID 58725406
methyl (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoate (PubChem CID 58725406) has the molecular formula C45H52N4O5 and a molecular weight of 728.93 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoate.
| Compound Name | methyl (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 58725406 |
| Molecular Formula | C45H52N4O5 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | methyl (2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-(nonoxymethylideneamino)propanoyl]amino]-4-oxo-4-(tritylamino)butanoate |
| SMILES | CCCCCCCCCO/C=N/[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C45H52N4O5/c1-3-4-5-6-7-8-20-29-54-33-47-40(30-34-32-46-39-28-19-18-27-38(34)39)43(51)48-41(44(52)53-2)31-42(50)49-45(35-21-12-9-13-22-35,36-23-14-10-15-24-36)37-25-16-11-17-26-37/h9-19,21-28,32-33,40-41,46H,3-8,20,29-31H2,1-2H3,(H,48,51)(H,49,50)/b47-33+/t40-,41-/m0/s1 |
| InChIKey | NNKPYWXESQBEFW-MWJHZPGGSA-N |
| XLogP | 8.03 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|