C15H16FN3O3 — CID 177168427
methyl 3-[3-(5-amino-2-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]azetidine-1-carboxylate (PubChem CID 177168427) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is methyl 3-[3-(5-amino-2-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]azetidine-1-carboxylate.
| Compound Name | methyl 3-[3-(5-amino-2-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 177168427 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl 3-[3-(5-amino-2-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]azetidine-1-carboxylate |
| SMILES | COC(=O)N1CC(c2cc(-c3cc(N)c(C)cc3F)no2)C1 |
| InChI | InChI=1S/C15H16FN3O3/c1-8-3-11(16)10(4-12(8)17)13-5-14(22-18-13)9-6-19(7-9)15(20)21-2/h3-5,9H,6-7,17H2,1-2H3 |
| InChIKey | UVEMVVDSOCOGDH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|