C18H29N5O2 — CID 171655762
ethane;methyl 3-[2-(3-amino-4-methylphenyl)triazol-4-yl]azetidine-1-carboxylate (PubChem CID 171655762) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is ethane;methyl 3-[2-(3-amino-4-methylphenyl)triazol-4-yl]azetidine-1-carboxylate.
| Compound Name | ethane;methyl 3-[2-(3-amino-4-methylphenyl)triazol-4-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171655762 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | ethane;methyl 3-[2-(3-amino-4-methylphenyl)triazol-4-yl]azetidine-1-carboxylate |
| SMILES | CC.CC.COC(=O)N1CC(c2cnn(-c3ccc(C)c(N)c3)n2)C1 |
| InChI | InChI=1S/C14H17N5O2.2C2H6/c1-9-3-4-11(5-12(9)15)19-16-6-13(17-19)10-7-18(8-10)14(20)21-2;2*1-2/h3-6,10H,7-8,15H2,1-2H3;2*1-2H3 |
| InChIKey | DCGGVWAQMKGDDX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|