C6H11NO — CID 177168614
(E,2S)-3-methanimidoylpent-3-en-2-ol (PubChem CID 177168614) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (E,2S)-3-methanimidoylpent-3-en-2-ol.
| Compound Name | (E,2S)-3-methanimidoylpent-3-en-2-ol |
|---|---|
| PubChem CID | 177168614 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (E,2S)-3-methanimidoylpent-3-en-2-ol |
| SMILES | [H]/N=C/C(=C\C)[C@H](C)O |
| InChI | InChI=1S/C6H11NO/c1-3-6(4-7)5(2)8/h3-5,7-8H,1-2H3/b6-3+,7-4+/t5-/m0/s1 |
| InChIKey | FIPWPQPQTSAYBH-LQCMYNHRSA-N |
| XLogP | 0.96 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|