C13H12BrF3N2O3 — CID 177169537
3-[4-(2-bromo-1,1-dimethoxyethyl)phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 177169537) has the molecular formula C13H12BrF3N2O3 and a molecular weight of 381.15 g/mol. Its IUPAC name is 3-[4-(2-bromo-1,1-dimethoxyethyl)phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(2-bromo-1,1-dimethoxyethyl)phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 177169537 |
| Molecular Formula | C13H12BrF3N2O3 |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 3-[4-(2-bromo-1,1-dimethoxyethyl)phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | COC(CBr)(OC)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H12BrF3N2O3/c1-20-12(7-14,21-2)9-5-3-8(4-6-9)10-18-11(22-19-10)13(15,16)17/h3-6H,7H2,1-2H3 |
| InChIKey | NOZHHENVJUEKHH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|