C5H7KN2 — CID 177171986
potassium 2,5-dimethyl-1,4-dihydroimidazol-4-ide (PubChem CID 177171986) has the molecular formula C5H7KN2 and a molecular weight of 134.22 g/mol. Its IUPAC name is potassium 2,5-dimethyl-1,4-dihydroimidazol-4-ide.
| Compound Name | potassium 2,5-dimethyl-1,4-dihydroimidazol-4-ide |
|---|---|
| PubChem CID | 177171986 |
| Molecular Formula | C5H7KN2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | potassium 2,5-dimethyl-1,4-dihydroimidazol-4-ide |
| SMILES | Cc1[c-]nc(C)[nH]1.[K+] |
| InChI | InChI=1S/C5H7N2.K/c1-4-3-6-5(2)7-4;/h1-2H3,(H,6,7);/q-1;+1 |
| InChIKey | JAQFQXHZLCIJAN-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|