C5H7N2Y- — CID 58637027
2,5-dimethyl-1,4-dihydroimidazol-4-ide;yttrium (PubChem CID 58637027) has the molecular formula C5H7N2Y- and a molecular weight of 184.03 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-dihydroimidazol-4-ide;yttrium.
| Compound Name | 2,5-dimethyl-1,4-dihydroimidazol-4-ide;yttrium |
|---|---|
| PubChem CID | 58637027 |
| Molecular Formula | C5H7N2Y- |
| Molecular Weight | 184.03 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | 2,5-dimethyl-1,4-dihydroimidazol-4-ide;yttrium |
| SMILES | Cc1[c-]nc(C)[nH]1.[Y] |
| InChI | InChI=1S/C5H7N2.Y/c1-4-3-6-5(2)7-4;/h1-2H3,(H,6,7);/q-1; |
| InChIKey | SOLXFEOBXDSKIM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.03 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|