C6H11ClN2 — CID 19877192
2,4,5-trimethyl-1H-imidazol-1-ium chloride (PubChem CID 19877192) has the molecular formula C6H11ClN2 and a molecular weight of 146.62 g/mol. Its IUPAC name is 2,4,5-trimethyl-1H-imidazol-1-ium chloride.
| Compound Name | 2,4,5-trimethyl-1H-imidazol-1-ium chloride |
|---|---|
| PubChem CID | 19877192 |
| Molecular Formula | C6H11ClN2 |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2,4,5-trimethyl-1H-imidazol-1-ium chloride |
| SMILES | CC1=NC(C)=C(C)[NH2+]1.[Cl-] |
| InChI | InChI=1S/C6H10N2.ClH/c1-4-5(2)8-6(3)7-4;/h1-3H3,(H,7,8);1H |
| InChIKey | NZXNIRRRIOMHIE-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |