C19H23ClN2O4S — CID 177177633
N-[3-(4-chlorobenzoyl)-4,5-dimethylthiophen-2-yl]formamide;methyl 3-aminobutanoate (PubChem CID 177177633) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is N-[3-(4-chlorobenzoyl)-4,5-dimethylthiophen-2-yl]formamide;methyl 3-aminobutanoate.
| Compound Name | N-[3-(4-chlorobenzoyl)-4,5-dimethylthiophen-2-yl]formamide;methyl 3-aminobutanoate |
|---|---|
| PubChem CID | 177177633 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[3-(4-chlorobenzoyl)-4,5-dimethylthiophen-2-yl]formamide;methyl 3-aminobutanoate |
| SMILES | COC(=O)CC(C)N.Cc1sc(NC=O)c(C(=O)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C14H12ClNO2S.C5H11NO2/c1-8-9(2)19-14(16-7-17)12(8)13(18)10-3-5-11(15)6-4-10;1-4(6)3-5(7)8-2/h3-7H,1-2H3,(H,16,17);4H,3,6H2,1-2H3 |
| InChIKey | NKBPYVHWYVWYLN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|