About 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole
5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole (PubChem CID 177179494) has the molecular formula C21H26N4
and a molecular weight of 334.47 g/mol. Its IUPAC name is 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole.
Molecular Properties
| Compound Name | 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole |
| PubChem CID | 177179494 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole |
| SMILES | CC(C)c1ccc2c(c1)ncn2C.CCc1ccc2c(cnn2C)c1 |
| InChI | InChI=1S/C11H14N2.C10H12N2/c1-8(2)9-4-5-11-10(6-9)12-7-13(11)3;1-3-8-4-5-10-9(6-8)7-11-12(10)2/h4-8H,1-3H3;4-7H,3H2,1-2H3 |
| InChIKey | LMDJDTRAFMUYEJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole?
The IUPAC name of 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole (CID 177179494) is 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole.
What is the SMILES notation for 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole?
The canonical SMILES for 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole is CC(C)c1ccc2c(c1)ncn2C.CCc1ccc2c(cnn2C)c1.
What is the InChIKey of 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole?
The InChIKey is LMDJDTRAFMUYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.C10H12N2/c1-8(2)9-4-5-11-10(6-9)12-7-13(11)3;1-3-8-4-5-10-9(6-8)7-11-12(10)2/h4-8H,1-3H3;4-7H,3H2,1-2H3.
What are the key properties of 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole?
5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole has a molecular weight of 334.47 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-methylindazole;1-methyl-5-propan-2-ylbenzimidazole is sourced from PubChem (CID 177179494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).