C27H42N4O9 — CID 177180342
(2S,3R,4S,5R,6R)-2-[4-[2-[1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]triazol-4-yl]ethyl]-2-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 177180342) has the molecular formula C27H42N4O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-[2-[1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]triazol-4-yl]ethyl]-2-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-[2-[1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]triazol-4-yl]ethyl]-2-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 177180342 |
| Molecular Formula | C27H42N4O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-[2-[1-[3-(2,2-dimethylbutoxy)-2,2-dimethylpropyl]triazol-4-yl]ethyl]-2-nitrophenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(C)(C)COCC(C)(C)Cn1cc(CCc2ccc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C27H42N4O9/c1-6-26(2,3)15-38-16-27(4,5)14-30-12-18(28-29-30)9-7-17-8-10-20(19(11-17)31(36)37)39-25-24(35)23(34)22(33)21(13-32)40-25/h8,10-12,21-25,32-35H,6-7,9,13-16H2,1-5H3/t21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | SGMGFDVSJPVFPI-ZLOLNMDISA-N |
| XLogP | 1.63 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|