C22H19NO8 — CID 71430889
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(6-nitropyren-1-yl)oxyoxane-3,4,5-triol (PubChem CID 71430889) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(6-nitropyren-1-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(6-nitropyren-1-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 71430889 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(6-nitropyren-1-yl)oxyoxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc2ccc3c(O[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)ccc4ccc1c2c43 |
| InChI | InChI=1S/C22H19NO8/c24-9-16-19(25)20(26)21(27)22(31-16)30-15-8-4-11-1-5-12-14(23(28)29)7-3-10-2-6-13(15)18(11)17(10)12/h1-8,16,19-22,24-27H,9H2/t16-,19+,20+,21-,22-/m1/s1 |
| InChIKey | NJHOPXVNTUWAOM-WIXLDOGYSA-N |
| XLogP | 1.67 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|