C10H13NO9 — CID 10424348
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(5-nitrofuran-2-yl)oxyoxane-3,4,5-triol (PubChem CID 10424348) has the molecular formula C10H13NO9 and a molecular weight of 291.21 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(5-nitrofuran-2-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(5-nitrofuran-2-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10424348 |
| Molecular Formula | C10H13NO9 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(5-nitrofuran-2-yl)oxyoxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)o1 |
| InChI | InChI=1S/C10H13NO9/c12-3-4-7(13)8(14)9(15)10(18-4)20-6-2-1-5(19-6)11(16)17/h1-2,4,7-10,12-15H,3H2/t4-,7-,8+,9-,10+/m1/s1 |
| InChIKey | HSBCZWPKFSLEKR-WJJJPAAKSA-N |
| XLogP | -1.63 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|