C36H50F3N5O2 — CID 177180667
ethane;N-[2-methyl-5-(6-methyl-1,8a-dihydroimidazo[1,2-a]pyrimidin-2-yl)phenyl]-4-[(2,2,4,4-tetramethylpentanoylamino)methyl]-2-(trifluoromethyl)benzamide (PubChem CID 177180667) has the molecular formula C36H50F3N5O2 and a molecular weight of 641.82 g/mol. Its IUPAC name is ethane;N-[2-methyl-5-(6-methyl-1,8a-dihydroimidazo[1,2-a]pyrimidin-2-yl)phenyl]-4-[(2,2,4,4-tetramethylpentanoylamino)methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | ethane;N-[2-methyl-5-(6-methyl-1,8a-dihydroimidazo[1,2-a]pyrimidin-2-yl)phenyl]-4-[(2,2,4,4-tetramethylpentanoylamino)methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 177180667 |
| Molecular Formula | C36H50F3N5O2 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | ethane;N-[2-methyl-5-(6-methyl-1,8a-dihydroimidazo[1,2-a]pyrimidin-2-yl)phenyl]-4-[(2,2,4,4-tetramethylpentanoylamino)methyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC.CC.CC1=CN2C=C(c3ccc(C)c(NC(=O)c4ccc(CNC(=O)C(C)(C)CC(C)(C)C)cc4C(F)(F)F)c3)NC2N=C1 |
| InChI | InChI=1S/C32H38F3N5O2.2C2H6/c1-19-14-37-29-39-26(17-40(29)16-19)22-10-8-20(2)25(13-22)38-27(41)23-11-9-21(12-24(23)32(33,34)35)15-36-28(42)31(6,7)18-30(3,4)5;2*1-2/h8-14,16-17,29,39H,15,18H2,1-7H3,(H,36,42)(H,38,41);2*1-2H3 |
| InChIKey | AMNDQJYOQHZNMH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |