C11H10F3N5O — CID 177181235
N'-hydroxy-6-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyridine-3-carboximidamide (PubChem CID 177181235) has the molecular formula C11H10F3N5O and a molecular weight of 285.23 g/mol. Its IUPAC name is N'-hydroxy-6-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 177181235 |
| Molecular Formula | C11H10F3N5O |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N'-hydroxy-6-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyridine-3-carboximidamide |
| SMILES | Cn1cc(C(F)(F)F)nc1-c1ccc(/C(N)=N/O)cn1 |
| InChI | InChI=1S/C11H10F3N5O/c1-19-5-8(11(12,13)14)17-10(19)7-3-2-6(4-16-7)9(15)18-20/h2-5,20H,1H3,(H2,15,18) |
| InChIKey | OJGZZEUPYMJKAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|