C26H27F4N3O3 — CID 177182712
[4-[(13R)-4-fluoro-13-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 177182712) has the molecular formula C26H27F4N3O3 and a molecular weight of 505.51 g/mol. Its IUPAC name is [4-[(13R)-4-fluoro-13-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-[(13R)-4-fluoro-13-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 177182712 |
| Molecular Formula | C26H27F4N3O3 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [4-[(13R)-4-fluoro-13-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | CO[C@@H]1CCCc2[nH]c3ncc(F)c(C4CCN(C(=O)c5ccc(OC(F)(F)F)cc5)CC4)c3c2C1 |
| InChI | InChI=1S/C26H27F4N3O3/c1-35-18-3-2-4-21-19(13-18)23-22(20(27)14-31-24(23)32-21)15-9-11-33(12-10-15)25(34)16-5-7-17(8-6-16)36-26(28,29)30/h5-8,14-15,18H,2-4,9-13H2,1H3,(H,31,32)/t18-/m1/s1 |
| InChIKey | NOGOIXLOXQZHSF-GOSISDBHSA-N |
| XLogP | 5.51 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |