C26H25F4N3O2 — CID 177182750
[4-[(1R,12S)-7-fluoro-3,5-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraen-8-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 177182750) has the molecular formula C26H25F4N3O2 and a molecular weight of 487.50 g/mol. Its IUPAC name is [4-[(1R,12S)-7-fluoro-3,5-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraen-8-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-[(1R,12S)-7-fluoro-3,5-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraen-8-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 177182750 |
| Molecular Formula | C26H25F4N3O2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [4-[(1R,12S)-7-fluoro-3,5-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraen-8-yl]piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N1CCC(c2c(F)cnc3[nH]c4c(c23)C[C@H]2CC[C@@H]4C2)CC1 |
| InChI | InChI=1S/C26H25F4N3O2/c27-20-13-31-24-22(19-12-14-1-2-17(11-14)23(19)32-24)21(20)15-7-9-33(10-8-15)25(34)16-3-5-18(6-4-16)35-26(28,29)30/h3-6,13-15,17H,1-2,7-12H2,(H,31,32)/t14-,17+/m0/s1 |
| InChIKey | DBFOLFCRMGWXPP-WMLDXEAASA-N |
| XLogP | 6.06 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |