C27H29F4N5O2 — CID 177182765
[2-amino-4-(trifluoromethoxy)phenyl]-[4-[(3S,8S)-13-fluoro-6,15,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-12-yl]piperidin-1-yl]methanone (PubChem CID 177182765) has the molecular formula C27H29F4N5O2 and a molecular weight of 531.55 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(3S,8S)-13-fluoro-6,15,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-12-yl]piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(3S,8S)-13-fluoro-6,15,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-12-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177182765 |
| Molecular Formula | C27H29F4N5O2 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(3S,8S)-13-fluoro-6,15,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-12-yl]piperidin-1-yl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)C[C@@H]2CNCC[C@H]2C4)CC1 |
| InChI | InChI=1S/C27H29F4N5O2/c28-20-13-34-25-24(19-9-16-12-33-6-3-15(16)10-22(19)35-25)23(20)14-4-7-36(8-5-14)26(37)18-2-1-17(11-21(18)32)38-27(29,30)31/h1-2,11,13-16,33H,3-10,12,32H2,(H,34,35)/t15-,16+/m0/s1 |
| InChIKey | SQPONDNCBNBIMB-JKSUJKDBSA-N |
| XLogP | 4.53 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|