C27H28F4N4O3 — CID 177182996
[2-amino-4-(trifluoromethoxy)phenyl]-[4-[(2S,7R)-15-fluoro-5-oxa-11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-16-yl]piperidin-1-yl]methanone (PubChem CID 177182996) has the molecular formula C27H28F4N4O3 and a molecular weight of 532.54 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(2S,7R)-15-fluoro-5-oxa-11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-16-yl]piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(2S,7R)-15-fluoro-5-oxa-11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-16-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177182996 |
| Molecular Formula | C27H28F4N4O3 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(2S,7R)-15-fluoro-5-oxa-11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12,14,16-tetraen-16-yl]piperidin-1-yl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)[C@H]2CCOC[C@@H]2CC4)CC1 |
| InChI | InChI=1S/C27H28F4N4O3/c28-19-12-33-25-24(23-17-7-10-37-13-15(17)1-4-21(23)34-25)22(19)14-5-8-35(9-6-14)26(36)18-3-2-16(11-20(18)32)38-27(29,30)31/h2-3,11-12,14-15,17H,1,4-10,13,32H2,(H,33,34)/t15-,17-/m0/s1 |
| InChIKey | BZMHKTDIHRCYGV-RDJZCZTQSA-N |
| XLogP | 5.27 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|