C26H26F4N4O3 — CID 177182951
[2-amino-4-(trifluoromethoxy)phenyl]-[4-(11-fluorospiro[7,9-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-3,3'-oxolane]-12-yl)piperidin-1-yl]methanone (PubChem CID 177182951) has the molecular formula C26H26F4N4O3 and a molecular weight of 518.51 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-(11-fluorospiro[7,9-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-3,3'-oxolane]-12-yl)piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-(11-fluorospiro[7,9-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-3,3'-oxolane]-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177182951 |
| Molecular Formula | C26H26F4N4O3 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-(11-fluorospiro[7,9-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-3,3'-oxolane]-12-yl)piperidin-1-yl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)C2(CCOC2)CC4)CC1 |
| InChI | InChI=1S/C26H26F4N4O3/c27-17-12-32-23-21(22-19(33-23)3-6-25(22)7-10-36-13-25)20(17)14-4-8-34(9-5-14)24(35)16-2-1-15(11-18(16)31)37-26(28,29)30/h1-2,11-12,14H,3-10,13,31H2,(H,32,33) |
| InChIKey | AMBIRKNGYSOPPE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|