C27H26F4N4O3 — CID 177182799
4-[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,2'-cyclobutane]-1'-one (PubChem CID 177182799) has the molecular formula C27H26F4N4O3 and a molecular weight of 530.52 g/mol. Its IUPAC name is 4-[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,2'-cyclobutane]-1'-one.
| Compound Name | 4-[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 177182799 |
| Molecular Formula | C27H26F4N4O3 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,2'-cyclobutane]-1'-one |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)CC2(CCC2=O)CC4)CC1 |
| InChI | InChI=1S/C27H26F4N4O3/c28-18-13-33-24-23(17-12-26(8-4-21(26)36)7-3-20(17)34-24)22(18)14-5-9-35(10-6-14)25(37)16-2-1-15(11-19(16)32)38-27(29,30)31/h1-2,11,13-14H,3-10,12,32H2,(H,33,34) |
| InChIKey | VUJVHHPJZWBJRF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|