C26H28F4N4O3 — CID 177182940
[2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone (PubChem CID 177182940) has the molecular formula C26H28F4N4O3 and a molecular weight of 520.53 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177182940 |
| Molecular Formula | C26H28F4N4O3 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-methoxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone |
| SMILES | CO[C@@H]1CCc2[nH]c3ncc(F)c(C4CCN(C(=O)c5ccc(OC(F)(F)F)cc5N)CC4)c3c2CC1 |
| InChI | InChI=1S/C26H28F4N4O3/c1-36-15-2-6-18-21(7-4-15)33-24-23(18)22(19(27)13-32-24)14-8-10-34(11-9-14)25(35)17-5-3-16(12-20(17)31)37-26(28,29)30/h3,5,12-15H,2,4,6-11,31H2,1H3,(H,32,33)/t15-/m0/s1 |
| InChIKey | LPLZYWFBGFURRM-HNNXBMFYSA-N |
| XLogP | 5.10 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|