C25H26F4N4O3 — CID 177182958
[2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-hydroxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone (PubChem CID 177182958) has the molecular formula C25H26F4N4O3 and a molecular weight of 506.50 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-hydroxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-hydroxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177182958 |
| Molecular Formula | C25H26F4N4O3 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-[(12S)-4-fluoro-12-hydroxy-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperidin-1-yl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)CC[C@H](O)CC4)CC1 |
| InChI | InChI=1S/C25H26F4N4O3/c26-18-12-31-23-22(17-4-1-14(34)2-6-20(17)32-23)21(18)13-7-9-33(10-8-13)24(35)16-5-3-15(11-19(16)30)36-25(27,28)29/h3,5,11-14,34H,1-2,4,6-10,30H2,(H,31,32)/t14-/m0/s1 |
| InChIKey | LMGIUUFDZBJVAQ-AWEZNQCLSA-N |
| XLogP | 4.44 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|