C26H27F4N5O2 — CID 177183041
[2-amino-4-(trifluoromethoxy)phenyl]-[4-(3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,3'-azetidine]-4-yl)piperidin-1-yl]methanone (PubChem CID 177183041) has the molecular formula C26H27F4N5O2 and a molecular weight of 517.53 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethoxy)phenyl]-[4-(3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,3'-azetidine]-4-yl)piperidin-1-yl]methanone.
| Compound Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-(3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,3'-azetidine]-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177183041 |
| Molecular Formula | C26H27F4N5O2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [2-amino-4-(trifluoromethoxy)phenyl]-[4-(3-fluorospiro[5,7,8,9-tetrahydropyrido[2,3-b]indole-6,3'-azetidine]-4-yl)piperidin-1-yl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(c2c(F)cnc3[nH]c4c(c23)CC2(CC4)CNC2)CC1 |
| InChI | InChI=1S/C26H27F4N5O2/c27-18-11-33-23-22(17-10-25(12-32-13-25)6-3-20(17)34-23)21(18)14-4-7-35(8-5-14)24(36)16-2-1-15(9-19(16)31)37-26(28,29)30/h1-2,9,11,14,32H,3-8,10,12-13,31H2,(H,33,34) |
| InChIKey | ARKFUQPTXKKEFZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|