C23H32N8O3 — CID 177185275
5-[[6-[3-(azepan-1-yl)propyl-methylamino]-5-nitropyrimidin-4-yl]amino]-1,3-dimethylbenzimidazol-2-one (PubChem CID 177185275) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 5-[[6-[3-(azepan-1-yl)propyl-methylamino]-5-nitropyrimidin-4-yl]amino]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[[6-[3-(azepan-1-yl)propyl-methylamino]-5-nitropyrimidin-4-yl]amino]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 177185275 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 5-[[6-[3-(azepan-1-yl)propyl-methylamino]-5-nitropyrimidin-4-yl]amino]-1,3-dimethylbenzimidazol-2-one |
| SMILES | CN(CCCN1CCCCCC1)c1ncnc(Nc2ccc3c(c2)n(C)c(=O)n3C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H32N8O3/c1-27(11-8-14-30-12-6-4-5-7-13-30)22-20(31(33)34)21(24-16-25-22)26-17-9-10-18-19(15-17)29(3)23(32)28(18)2/h9-10,15-16H,4-8,11-14H2,1-3H3,(H,24,25,26) |
| InChIKey | GUFWNMLAYUKGHG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|