C35H45ClFN3O4 — CID 177189955
(2E,3E,5Z)-4-[3-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]prop-1-en-2-yl-(2-methoxyethyl)amino]-2-ethylidene-5,6-dimethylocta-3,5-dienoic acid (PubChem CID 177189955) has the molecular formula C35H45ClFN3O4 and a molecular weight of 626.21 g/mol. Its IUPAC name is (2E,3E,5Z)-4-[3-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]prop-1-en-2-yl-(2-methoxyethyl)amino]-2-ethylidene-5,6-dimethylocta-3,5-dienoic acid.
| Compound Name | (2E,3E,5Z)-4-[3-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]prop-1-en-2-yl-(2-methoxyethyl)amino]-2-ethylidene-5,6-dimethylocta-3,5-dienoic acid |
|---|---|
| PubChem CID | 177189955 |
| Molecular Formula | C35H45ClFN3O4 |
| Molecular Weight | 626.21 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | (2E,3E,5Z)-4-[3-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]prop-1-en-2-yl-(2-methoxyethyl)amino]-2-ethylidene-5,6-dimethylocta-3,5-dienoic acid |
| SMILES | C=C(CN1CCC(c2cccc(OCc3ccc(Cl)cc3F)n2)CC1)N(CCOC)C(=C/C(=C\C)C(=O)O)/C(C)=C(/C)CC |
| InChI | InChI=1S/C35H45ClFN3O4/c1-7-24(3)26(5)33(20-27(8-2)35(41)42)40(18-19-43-6)25(4)22-39-16-14-28(15-17-39)32-10-9-11-34(38-32)44-23-29-12-13-30(36)21-31(29)37/h8-13,20-21,28H,4,7,14-19,22-23H2,1-3,5-6H3,(H,41,42)/b26-24-,27-8+,33-20+ |
| InChIKey | OLPPGAIQSDJARD-SDHJYQILSA-N |
| XLogP | 7.76 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.21 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|