C25H40N2O8S — CID 177191477
tert-butyl 3-[2-[2-[2-[2-[4-[(Z)-N-(methylideneamino)-C-(methylsulfanylmethoxy)carbonimidoyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 177191477) has the molecular formula C25H40N2O8S and a molecular weight of 528.67 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[2-[4-[(Z)-N-(methylideneamino)-C-(methylsulfanylmethoxy)carbonimidoyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[2-[4-[(Z)-N-(methylideneamino)-C-(methylsulfanylmethoxy)carbonimidoyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 177191477 |
| Molecular Formula | C25H40N2O8S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[2-[4-[(Z)-N-(methylideneamino)-C-(methylsulfanylmethoxy)carbonimidoyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C=N/N=C(\OCSC)c1ccc(OCCOCCOCCOCCOCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H40N2O8S/c1-25(2,3)35-23(28)10-11-29-12-13-30-14-15-31-16-17-32-18-19-33-22-8-6-21(7-9-22)24(27-26-4)34-20-36-5/h6-9H,4,10-20H2,1-3,5H3/b27-24- |
| InChIKey | BQQUHVKWVPAPIP-PNHLSOANSA-N |
| XLogP | 3.56 |
| TPSA | 106.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|