C11H9N5O — CID 177191894
6-N-(1,3-oxazol-2-yl)quinazoline-4,6-diamine (PubChem CID 177191894) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is 6-N-(1,3-oxazol-2-yl)quinazoline-4,6-diamine.
| Compound Name | 6-N-(1,3-oxazol-2-yl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 177191894 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-N-(1,3-oxazol-2-yl)quinazoline-4,6-diamine |
| SMILES | Nc1ncnc2ccc(Nc3ncco3)cc12 |
| InChI | InChI=1S/C11H9N5O/c12-10-8-5-7(16-11-13-3-4-17-11)1-2-9(8)14-6-15-10/h1-6H,(H,13,16)(H2,12,14,15) |
| InChIKey | RZTPYVLJHLAZNZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |